C32H34Br2N4O3S2 — CID 157423774
[(1R,3R)-3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclopentyl] methanesulfonate;3-bromo-5-isocyano-6-methyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]indole (PubChem CID 157423774) has the molecular formula C32H34Br2N4O3S2 and a molecular weight of 746.59 g/mol. Its IUPAC name is [(1R,3R)-3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclopentyl] methanesulfonate;3-bromo-5-isocyano-6-methyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]indole.
| Compound Name | [(1R,3R)-3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclopentyl] methanesulfonate;3-bromo-5-isocyano-6-methyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]indole |
|---|---|
| PubChem CID | 157423774 |
| Molecular Formula | C32H34Br2N4O3S2 |
| Molecular Weight | 746.59 g/mol |
| Exact Mass | 744.04 |
| IUPAC Name | [(1R,3R)-3-(3-bromo-5-isocyano-6-methylindol-1-yl)cyclopentyl] methanesulfonate;3-bromo-5-isocyano-6-methyl-1-[(1R,3S)-3-methylsulfanylcyclopentyl]indole |
| SMILES | [C-]#[N+]c1cc2c(Br)cn([C@@H]3CC[C@@H](OS(C)(=O)=O)C3)c2cc1C.[C-]#[N+]c1cc2c(Br)cn([C@@H]3CC[C@H](SC)C3)c2cc1C |
| InChI | InChI=1S/C16H17BrN2O3S.C16H17BrN2S/c1-10-6-16-13(8-15(10)18-2)14(17)9-19(16)11-4-5-12(7-11)22-23(3,20)21;1-10-6-16-13(8-15(10)18-2)14(17)9-19(16)11-4-5-12(7-11)20-3/h6,8-9,11-12H,4-5,7H2,1,3H3;6,8-9,11-12H,4-5,7H2,1,3H3/t11-,12-;11-,12+/m11/s1 |
| InChIKey | BPSJWKPUSGEBTQ-VAMWZMCWSA-N |
| XLogP | 10.05 |
| TPSA | 61.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.59 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|