About ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate
ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 157423807) has the molecular formula C25H31F3O9S
and a molecular weight of 564.58 g/mol. Its IUPAC name is ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate.
Molecular Properties
| Compound Name | ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate |
| PubChem CID | 157423807 |
| Molecular Formula | C25H31F3O9S |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | CCOC(=O)c1ccc(CC(C)C)c(OC)c1.CCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C14H20O3.C11H11F3O6S/c1-5-17-14(15)12-7-6-11(8-10(2)3)13(9-12)16-4;1-3-19-10(15)7-4-5-8(9(6-7)18-2)20-21(16,17)11(12,13)14/h6-7,9-10H,5,8H2,1-4H3;4-6H,3H2,1-2H3 |
| InChIKey | BPSLTELPVNEWBG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate?
The IUPAC name of ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate (CID 157423807) is ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate.
What is the SMILES notation for ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate?
The canonical SMILES for ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate is CCOC(=O)c1ccc(CC(C)C)c(OC)c1.CCOC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c(OC)c1.
What is the InChIKey of ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate?
The InChIKey is BPSLTELPVNEWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3.C11H11F3O6S/c1-5-17-14(15)12-7-6-11(8-10(2)3)13(9-12)16-4;1-3-19-10(15)7-4-5-8(9(6-7)18-2)20-21(16,17)11(12,13)14/h6-7,9-10H,5,8H2,1-4H3;4-6H,3H2,1-2H3.
What are the key properties of ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate?
ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate has a molecular weight of 564.58 g/mol, XLogP of 5.17, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methoxy-4-(2-methylpropyl)benzoate;ethyl 3-methoxy-4-(trifluoromethylsulfonyloxy)benzoate is sourced from PubChem (CID 157423807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).