About dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate
dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate (PubChem CID 157424151) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate.
Molecular Properties
| Compound Name | dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate |
| PubChem CID | 157424151 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate |
| SMILES | COC(=O)CC(c1ccc2c(c1)C(C)CC2)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C19H26O4/c1-12-6-7-13-8-9-14(10-15(12)13)16(11-17(20)22-4)19(2,3)18(21)23-5/h8-10,12,16H,6-7,11H2,1-5H3 |
| InChIKey | BPTLVZRFSDEWRJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate?
The IUPAC name of dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate (CID 157424151) is dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate.
What is the SMILES notation for dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate?
The canonical SMILES for dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate is COC(=O)CC(c1ccc2c(c1)C(C)CC2)C(C)(C)C(=O)OC.
What is the InChIKey of dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate?
The InChIKey is BPTLVZRFSDEWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4/c1-12-6-7-13-8-9-14(10-15(12)13)16(11-17(20)22-4)19(2,3)18(21)23-5/h8-10,12,16H,6-7,11H2,1-5H3.
What are the key properties of dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate?
dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate has a molecular weight of 318.41 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,2-dimethyl-3-(3-methyl-2,3-dihydro-1H-inden-5-yl)pentanedioate is sourced from PubChem (CID 157424151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).