C11H18N2O — CID 15742428
3-methoxy-6-(1,2,3,4-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyridine (PubChem CID 15742428) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-methoxy-6-(1,2,3,4-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyridine.
| Compound Name | 3-methoxy-6-(1,2,3,4-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 15742428 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-methoxy-6-(1,2,3,4-tetrahydropyridin-5-yl)-1,2,3,4-tetrahydropyridine |
| SMILES | COC1CC=C(C2=CNCCC2)NC1 |
| InChI | InChI=1S/C11H18N2O/c1-14-10-4-5-11(13-8-10)9-3-2-6-12-7-9/h5,7,10,12-13H,2-4,6,8H2,1H3 |
| InChIKey | YPZGQHMULJYTTC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |