C42H37N3OS — CID 157424302
(2E)-2-[[4-[4-[3,5-bis(3,5-dimethylphenyl)-2,4,6-trimethylphenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]-3-oxobutanenitrile (PubChem CID 157424302) has the molecular formula C42H37N3OS and a molecular weight of 631.85 g/mol. Its IUPAC name is (2E)-2-[[4-[4-[3,5-bis(3,5-dimethylphenyl)-2,4,6-trimethylphenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]-3-oxobutanenitrile.
| Compound Name | (2E)-2-[[4-[4-[3,5-bis(3,5-dimethylphenyl)-2,4,6-trimethylphenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 157424302 |
| Molecular Formula | C42H37N3OS |
| Molecular Weight | 631.85 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | (2E)-2-[[4-[4-[3,5-bis(3,5-dimethylphenyl)-2,4,6-trimethylphenyl]-2,1,3-benzothiadiazol-7-yl]phenyl]methylidene]-3-oxobutanenitrile |
| SMILES | CC(=O)/C(C#N)=C/c1ccc(-c2ccc(-c3c(C)c(-c4cc(C)cc(C)c4)c(C)c(-c4cc(C)cc(C)c4)c3C)c3nsnc23)cc1 |
| InChI | InChI=1S/C42H37N3OS/c1-23-15-24(2)18-33(17-23)38-27(5)39(34-19-25(3)16-26(4)20-34)29(7)40(28(38)6)37-14-13-36(41-42(37)45-47-44-41)32-11-9-31(10-12-32)21-35(22-43)30(8)46/h9-21H,1-8H3/b35-21+ |
| InChIKey | VJRVJTMTRRQPEX-XICOUIIWSA-N |
| XLogP | 11.01 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.85 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|