C9H12O4 — CID 15742453
(2R,3S)-3-hydroxy-2-methyl-5-[(2S,3R)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one (PubChem CID 15742453) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-methyl-5-[(2S,3R)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one.
| Compound Name | (2R,3S)-3-hydroxy-2-methyl-5-[(2S,3R)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 15742453 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-methyl-5-[(2S,3R)-3-methyloxiran-2-yl]-2,3-dihydropyran-6-one |
| SMILES | C[C@H]1OC(=O)C([C@@H]2O[C@@H]2C)=C[C@@H]1O |
| InChI | InChI=1S/C9H12O4/c1-4-7(10)3-6(9(11)13-4)8-5(2)12-8/h3-5,7-8,10H,1-2H3/t4-,5-,7+,8-/m1/s1 |
| InChIKey | RCAULRNMJFUWRP-HXOWADHMSA-N |
| XLogP | 0.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|