C38H38N8O5S — CID 157427408
3-[[4-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]methyl]-5-(1,3-thiazol-2-yl)pyrazine-2-carboxamide (PubChem CID 157427408) has the molecular formula C38H38N8O5S and a molecular weight of 718.84 g/mol. Its IUPAC name is 3-[[4-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]methyl]-5-(1,3-thiazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-[[4-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]methyl]-5-(1,3-thiazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 157427408 |
| Molecular Formula | C38H38N8O5S |
| Molecular Weight | 718.84 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | 3-[[4-[9-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-3,9-diazaspiro[5.5]undecan-3-yl]phenyl]methyl]-5-(1,3-thiazol-2-yl)pyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(-c2nccs2)nc1Cc1ccc(N2CCC3(CCN(Cc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C38H38N8O5S/c39-33(48)32-28(42-29(21-41-32)35-40-13-18-52-35)20-23-1-4-25(5-2-23)45-16-11-38(12-17-45)9-14-44(15-10-38)22-24-3-6-26-27(19-24)37(51)46(36(26)50)30-7-8-31(47)43-34(30)49/h1-6,13,18-19,21,30H,7-12,14-17,20,22H2,(H2,39,48)(H,43,47,49) |
| InChIKey | BQCUJLLWANGOMU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 171.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|