C16H32N6 — CID 157429631
2-N-[[ethyl(methyl)amino]methyl]-2-N,6-dimethyl-4-N-(2,3,3-trimethylbutan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 157429631) has the molecular formula C16H32N6 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-N-[[ethyl(methyl)amino]methyl]-2-N,6-dimethyl-4-N-(2,3,3-trimethylbutan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[[ethyl(methyl)amino]methyl]-2-N,6-dimethyl-4-N-(2,3,3-trimethylbutan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157429631 |
| Molecular Formula | C16H32N6 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-N-[[ethyl(methyl)amino]methyl]-2-N,6-dimethyl-4-N-(2,3,3-trimethylbutan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(C)CN(C)c1nc(C)nc(NC(C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C16H32N6/c1-10-21(8)11-22(9)14-18-12(2)17-13(19-14)20-16(6,7)15(3,4)5/h10-11H2,1-9H3,(H,17,18,19,20) |
| InChIKey | BNKJAAULCSBGEN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|