About 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione
2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione (PubChem CID 15743021) has the molecular formula C18H12O3
and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione.
Molecular Properties
| Compound Name | 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
| PubChem CID | 15743021 |
| Molecular Formula | C18H12O3 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1CC(c1ccccc1)O2 |
| InChI | InChI=1S/C18H12O3/c19-16-12-8-4-5-9-13(12)18-14(17(16)20)10-15(21-18)11-6-2-1-3-7-11/h1-9,15H,10H2 |
| InChIKey | FWWUHHCGSZBPMS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione?
The IUPAC name of 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione (CID 15743021) is 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione.
What is the SMILES notation for 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione?
The canonical SMILES for 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione is O=C1C(=O)c2ccccc2C2=C1CC(c1ccccc1)O2.
What is the InChIKey of 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione?
The InChIKey is FWWUHHCGSZBPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O3/c19-16-12-8-4-5-9-13(12)18-14(17(16)20)10-15(21-18)11-6-2-1-3-7-11/h1-9,15H,10H2.
What are the key properties of 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione?
2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione has a molecular weight of 276.29 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione is sourced from PubChem (CID 15743021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).