About 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone
1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone (PubChem CID 15743055) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone.
Molecular Properties
| Compound Name | 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone |
| PubChem CID | 15743055 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone |
| SMILES | CC(=O)C1CC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C11H14O/c1-6(12)9-5-10-7-2-3-8(4-7)11(9)10/h2-3,7-11H,4-5H2,1H3 |
| InChIKey | YDQGIGNBUGEHRW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone?
The IUPAC name of 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone (CID 15743055) is 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone.
What is the SMILES notation for 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone?
The canonical SMILES for 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone is CC(=O)C1CC2C3C=CC(C3)C12.
What is the InChIKey of 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone?
The InChIKey is YDQGIGNBUGEHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-6(12)9-5-10-7-2-3-8(4-7)11(9)10/h2-3,7-11H,4-5H2,1H3.
What are the key properties of 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone?
1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone has a molecular weight of 162.23 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tricyclo[4.2.1.02,5]non-7-enyl)ethanone is sourced from PubChem (CID 15743055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).