C23H29NO3 — CID 15743135
propan-2-yl (E,2R,3R)-3-(benzylamino)-2-[hydroxy(phenyl)methyl]hex-4-enoate (PubChem CID 15743135) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is propan-2-yl (E,2R,3R)-3-(benzylamino)-2-[hydroxy(phenyl)methyl]hex-4-enoate.
| Compound Name | propan-2-yl (E,2R,3R)-3-(benzylamino)-2-[hydroxy(phenyl)methyl]hex-4-enoate |
|---|---|
| PubChem CID | 15743135 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | propan-2-yl (E,2R,3R)-3-(benzylamino)-2-[hydroxy(phenyl)methyl]hex-4-enoate |
| SMILES | C/C=C/[C@@H](NCc1ccccc1)[C@@H](C(=O)OC(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-4-11-20(24-16-18-12-7-5-8-13-18)21(23(26)27-17(2)3)22(25)19-14-9-6-10-15-19/h4-15,17,20-22,24-25H,16H2,1-3H3/b11-4+/t20-,21-,22?/m1/s1 |
| InChIKey | YEKMYJDKVHBVHR-CDOWNMCXSA-N |
| XLogP | 4.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|