C30H43N3O2Si — CID 157431527
4-[tert-butyl(dimethyl)silyl]oxy-1-[2-methyl-4-[[(1R)-1-(3-methylphenyl)ethyl]amino]quinazolin-6-yl]cyclohexan-1-ol (PubChem CID 157431527) has the molecular formula C30H43N3O2Si and a molecular weight of 505.78 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-[2-methyl-4-[[(1R)-1-(3-methylphenyl)ethyl]amino]quinazolin-6-yl]cyclohexan-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-[2-methyl-4-[[(1R)-1-(3-methylphenyl)ethyl]amino]quinazolin-6-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 157431527 |
| Molecular Formula | C30H43N3O2Si |
| Molecular Weight | 505.78 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-[2-methyl-4-[[(1R)-1-(3-methylphenyl)ethyl]amino]quinazolin-6-yl]cyclohexan-1-ol |
| SMILES | Cc1cccc([C@@H](C)Nc2nc(C)nc3ccc(C4(O)CCC(O[Si](C)(C)C(C)(C)C)CC4)cc23)c1 |
| InChI | InChI=1S/C30H43N3O2Si/c1-20-10-9-11-23(18-20)21(2)31-28-26-19-24(12-13-27(26)32-22(3)33-28)30(34)16-14-25(15-17-30)35-36(7,8)29(4,5)6/h9-13,18-19,21,25,34H,14-17H2,1-8H3,(H,31,32,33)/t21-,25?,30?/m1/s1 |
| InChIKey | BQPCSSYJICKUEP-ASHIEUMCSA-N |
| XLogP | 7.57 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|