About 1-methyltriazole;quinoline
1-methyltriazole;quinoline (PubChem CID 157432615) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-methyltriazole;quinoline.
Molecular Properties
| Compound Name | 1-methyltriazole;quinoline |
| PubChem CID | 157432615 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-methyltriazole;quinoline |
| SMILES | Cn1ccnn1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C3H5N3/c1-2-6-9-8(4-1)5-3-7-10-9;1-6-3-2-4-5-6/h1-7H;2-3H,1H3 |
| InChIKey | BQSJQYUWXRVFIS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyltriazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyltriazole;quinoline?
The IUPAC name of 1-methyltriazole;quinoline (CID 157432615) is 1-methyltriazole;quinoline.
What is the SMILES notation for 1-methyltriazole;quinoline?
The canonical SMILES for 1-methyltriazole;quinoline is Cn1ccnn1.c1ccc2ncccc2c1.
What is the InChIKey of 1-methyltriazole;quinoline?
The InChIKey is BQSJQYUWXRVFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H5N3/c1-2-6-9-8(4-1)5-3-7-10-9;1-6-3-2-4-5-6/h1-7H;2-3H,1H3.
What are the key properties of 1-methyltriazole;quinoline?
1-methyltriazole;quinoline has a molecular weight of 212.26 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyltriazole;quinoline is sourced from PubChem (CID 157432615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).