C19H26N2O7 — CID 157434675
(4S,7R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7,9-dimethyl-5,8-dioxodecanoic acid (PubChem CID 157434675) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is (4S,7R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7,9-dimethyl-5,8-dioxodecanoic acid.
| Compound Name | (4S,7R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7,9-dimethyl-5,8-dioxodecanoic acid |
|---|---|
| PubChem CID | 157434675 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (4S,7R)-4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-7,9-dimethyl-5,8-dioxodecanoic acid |
| SMILES | CC(C)C(=O)[C@H](C)CC(=O)[C@H](CCC(=O)O)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H26N2O7/c1-11(2)19(28)12(3)10-14(22)13(4-7-18(26)27)20-15(23)8-9-21-16(24)5-6-17(21)25/h5-6,11-13H,4,7-10H2,1-3H3,(H,20,23)(H,26,27)/t12-,13+/m1/s1 |
| InChIKey | FEUOEBHPJFUEET-OLZOCXBDSA-N |
| XLogP | 0.47 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|