About decyl dihydrogen phosphate;2-methylprop-1-ene
decyl dihydrogen phosphate;2-methylprop-1-ene (PubChem CID 157434751) has the molecular formula C14H31O4P
and a molecular weight of 294.37 g/mol. Its IUPAC name is decyl dihydrogen phosphate;2-methylprop-1-ene.
Molecular Properties
| Compound Name | decyl dihydrogen phosphate;2-methylprop-1-ene |
| PubChem CID | 157434751 |
| Molecular Formula | C14H31O4P |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | decyl dihydrogen phosphate;2-methylprop-1-ene |
| SMILES | C=C(C)C.CCCCCCCCCCOP(=O)(O)O |
| InChI | InChI=1S/C10H23O4P.C4H8/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;1-4(2)3/h2-10H2,1H3,(H2,11,12,13);1H2,2-3H3 |
| InChIKey | BQYVDLKCWMDYAH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze decyl dihydrogen phosphate;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl dihydrogen phosphate;2-methylprop-1-ene?
The IUPAC name of decyl dihydrogen phosphate;2-methylprop-1-ene (CID 157434751) is decyl dihydrogen phosphate;2-methylprop-1-ene.
What is the SMILES notation for decyl dihydrogen phosphate;2-methylprop-1-ene?
The canonical SMILES for decyl dihydrogen phosphate;2-methylprop-1-ene is C=C(C)C.CCCCCCCCCCOP(=O)(O)O.
What is the InChIKey of decyl dihydrogen phosphate;2-methylprop-1-ene?
The InChIKey is BQYVDLKCWMDYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O4P.C4H8/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;1-4(2)3/h2-10H2,1H3,(H2,11,12,13);1H2,2-3H3.
What are the key properties of decyl dihydrogen phosphate;2-methylprop-1-ene?
decyl dihydrogen phosphate;2-methylprop-1-ene has a molecular weight of 294.37 g/mol, XLogP of 4.82, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl dihydrogen phosphate;2-methylprop-1-ene is sourced from PubChem (CID 157434751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).