About methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate
methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate (PubChem CID 157434836) has the molecular formula C21H21ClN2O4
and a molecular weight of 400.86 g/mol. Its IUPAC name is methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate.
Molecular Properties
| Compound Name | methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate |
| PubChem CID | 157434836 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate |
| SMILES | C.COC(=O)c1ccc2[nH]cc(Cl)c2c1.COC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C10H8ClNO2.C10H9NO2.CH4/c1-14-10(13)6-2-3-9-7(4-6)8(11)5-12-9;1-13-10(12)8-2-3-9-7(6-8)4-5-11-9;/h2-5,12H,1H3;2-6,11H,1H3;1H4 |
| InChIKey | BQYZNTBOYNYHOH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate?
The IUPAC name of methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate (CID 157434836) is methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate.
What is the SMILES notation for methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate?
The canonical SMILES for methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate is C.COC(=O)c1ccc2[nH]cc(Cl)c2c1.COC(=O)c1ccc2[nH]ccc2c1.
What is the InChIKey of methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate?
The InChIKey is BQYZNTBOYNYHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO2.C10H9NO2.CH4/c1-14-10(13)6-2-3-9-7(4-6)8(11)5-12-9;1-13-10(12)8-2-3-9-7(6-8)4-5-11-9;/h2-5,12H,1H3;2-6,11H,1H3;1H4.
What are the key properties of methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate?
methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate has a molecular weight of 400.86 g/mol, XLogP of 5.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 3-chloro-1H-indole-5-carboxylate;methyl 1H-indole-5-carboxylate is sourced from PubChem (CID 157434836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).