C10H6O4S6 — CID 15743649
2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylic acid (PubChem CID 15743649) has the molecular formula C10H6O4S6 and a molecular weight of 382.56 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylic acid.
| Compound Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 15743649 |
| Molecular Formula | C10H6O4S6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 381.86 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-1,3-dithiole-4,5-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)SC(=C2SC3=C(SCCS3)S2)S1 |
| InChI | InChI=1S/C10H6O4S6/c11-5(12)3-4(6(13)14)18-9(17-3)10-19-7-8(20-10)16-2-1-15-7/h1-2H2,(H,11,12)(H,13,14) |
| InChIKey | UKBKJHLQCQRPBM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |