About 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine
1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine (PubChem CID 157437052) has the molecular formula C14H18ClNO
and a molecular weight of 251.76 g/mol. Its IUPAC name is 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine |
| PubChem CID | 157437052 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine |
| SMILES | C=C(C1COc2c(C)cc(Cl)cc2C1)N(C)C |
| InChI | InChI=1S/C14H18ClNO/c1-9-5-13(15)7-11-6-12(8-17-14(9)11)10(2)16(3)4/h5,7,12H,2,6,8H2,1,3-4H3 |
| InChIKey | AANRIDMFOVQPBD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine?
The IUPAC name of 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine (CID 157437052) is 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine.
What is the SMILES notation for 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine?
The canonical SMILES for 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine is C=C(C1COc2c(C)cc(Cl)cc2C1)N(C)C.
What is the InChIKey of 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine?
The InChIKey is AANRIDMFOVQPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO/c1-9-5-13(15)7-11-6-12(8-17-14(9)11)10(2)16(3)4/h5,7,12H,2,6,8H2,1,3-4H3.
What are the key properties of 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine?
1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine has a molecular weight of 251.76 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-8-methyl-3,4-dihydro-2H-chromen-3-yl)-N,N-dimethylethenamine is sourced from PubChem (CID 157437052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).