C51H36N6O6 — CID 157439024
3-[1-(2-hydroxyethyl)indol-3-yl]-4-(1-quinolin-3-ylindol-3-yl)pyrrole-2,5-dione;methyl 2-oxo-2-(1-quinolin-3-ylindol-3-yl)acetate (PubChem CID 157439024) has the molecular formula C51H36N6O6 and a molecular weight of 828.89 g/mol. Its IUPAC name is 3-[1-(2-hydroxyethyl)indol-3-yl]-4-(1-quinolin-3-ylindol-3-yl)pyrrole-2,5-dione;methyl 2-oxo-2-(1-quinolin-3-ylindol-3-yl)acetate.
| Compound Name | 3-[1-(2-hydroxyethyl)indol-3-yl]-4-(1-quinolin-3-ylindol-3-yl)pyrrole-2,5-dione;methyl 2-oxo-2-(1-quinolin-3-ylindol-3-yl)acetate |
|---|---|
| PubChem CID | 157439024 |
| Molecular Formula | C51H36N6O6 |
| Molecular Weight | 828.89 g/mol |
| Exact Mass | 828.27 |
| IUPAC Name | 3-[1-(2-hydroxyethyl)indol-3-yl]-4-(1-quinolin-3-ylindol-3-yl)pyrrole-2,5-dione;methyl 2-oxo-2-(1-quinolin-3-ylindol-3-yl)acetate |
| SMILES | COC(=O)C(=O)c1cn(-c2cnc3ccccc3c2)c2ccccc12.O=C1NC(=O)C(c2cn(-c3cnc4ccccc4c3)c3ccccc23)=C1c1cn(CCO)c2ccccc12 |
| InChI | InChI=1S/C31H22N4O3.C20H14N2O3/c36-14-13-34-17-23(21-8-2-5-11-26(21)34)28-29(31(38)33-30(28)37)24-18-35(27-12-6-3-9-22(24)27)20-15-19-7-1-4-10-25(19)32-16-20;1-25-20(24)19(23)16-12-22(18-9-5-3-7-15(16)18)14-10-13-6-2-4-8-17(13)21-11-14/h1-12,15-18,36H,13-14H2,(H,33,37,38);2-12H,1H3 |
| InChIKey | BRLGKBBIUFMIAT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.89 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|