About methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate
methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate (PubChem CID 157440074) has the molecular formula C22H33N2O3+
and a molecular weight of 373.52 g/mol. Its IUPAC name is methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate.
Molecular Properties
| Compound Name | methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate |
| PubChem CID | 157440074 |
| Molecular Formula | C22H33N2O3+ |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate |
| SMILES | CC[N+]1(C2(C(=O)Nc3c(C)cc(C)cc3C(=O)OC)CC2)CCCCCC1 |
| InChI | InChI=1S/C22H32N2O3/c1-5-24(12-8-6-7-9-13-24)22(10-11-22)21(26)23-19-17(3)14-16(2)15-18(19)20(25)27-4/h14-15H,5-13H2,1-4H3/p+1 |
| InChIKey | NCNZHFHBPPVKIZ-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate?
The IUPAC name of methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate (CID 157440074) is methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate.
What is the SMILES notation for methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate?
The canonical SMILES for methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate is CC[N+]1(C2(C(=O)Nc3c(C)cc(C)cc3C(=O)OC)CC2)CCCCCC1.
What is the InChIKey of methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate?
The InChIKey is NCNZHFHBPPVKIZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H32N2O3/c1-5-24(12-8-6-7-9-13-24)22(10-11-22)21(26)23-19-17(3)14-16(2)15-18(19)20(25)27-4/h14-15H,5-13H2,1-4H3/p+1.
What are the key properties of methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate?
methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate has a molecular weight of 373.52 g/mol, XLogP of 3.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[1-(1-ethylazepan-1-ium-1-yl)cyclopropanecarbonyl]amino]-3,5-dimethylbenzoate is sourced from PubChem (CID 157440074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).