C34H32N3P — CID 157440294
[3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]phenyl]-methyl-(4-methyl-2-pyridinyl)phosphane (PubChem CID 157440294) has the molecular formula C34H32N3P and a molecular weight of 513.63 g/mol. Its IUPAC name is [3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]phenyl]-methyl-(4-methyl-2-pyridinyl)phosphane.
| Compound Name | [3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]phenyl]-methyl-(4-methyl-2-pyridinyl)phosphane |
|---|---|
| PubChem CID | 157440294 |
| Molecular Formula | C34H32N3P |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | [3-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]phenyl]-methyl-(4-methyl-2-pyridinyl)phosphane |
| SMILES | Cc1ccnc(P(C)c2cccc(-c3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)c1 |
| InChI | InChI=1S/C34H32N3P/c1-23-15-17-36-33(19-23)38(5)27-10-8-9-24(20-27)25-13-14-29-28-11-6-7-12-30(28)37(31(29)21-25)32-22-26(16-18-35-32)34(2,3)4/h6-22H,1-5H3 |
| InChIKey | IZYGWPDIDCEPOG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|