About 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one
2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 157441103) has the molecular formula C7H13NOS2
and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one |
| PubChem CID | 157441103 |
| Molecular Formula | C7H13NOS2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | CC(C)C.O=C1NCC(=S)S1 |
| InChI | InChI=1S/C4H10.C3H3NOS2/c1-4(2)3;5-3-4-1-2(6)7-3/h4H,1-3H3;1H2,(H,4,5) |
| InChIKey | BRRJTELMYFWZTK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one?
The IUPAC name of 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one (CID 157441103) is 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one.
What is the SMILES notation for 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one?
The canonical SMILES for 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one is CC(C)C.O=C1NCC(=S)S1.
What is the InChIKey of 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one?
The InChIKey is BRRJTELMYFWZTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H3NOS2/c1-4(2)3;5-3-4-1-2(6)7-3/h4H,1-3H3;1H2,(H,4,5).
What are the key properties of 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one?
2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one has a molecular weight of 191.32 g/mol, XLogP of 2.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;5-sulfanylidene-1,3-thiazolidin-2-one is sourced from PubChem (CID 157441103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).