About 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese
9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese (PubChem CID 157442351) has the molecular formula C30H46MnO4S
and a molecular weight of 557.70 g/mol. Its IUPAC name is 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese.
Molecular Properties
| Compound Name | 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese |
| PubChem CID | 157442351 |
| Molecular Formula | C30H46MnO4S |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese |
| SMILES | O=S(=O)(c1ccccc1CCCCCCCCCO)c1ccccc1CCCCCCCCCO.[Mn] |
| InChI | InChI=1S/C30H46O4S.Mn/c31-25-17-9-5-1-3-7-11-19-27-21-13-15-23-29(27)35(33,34)30-24-16-14-22-28(30)20-12-8-4-2-6-10-18-26-32;/h13-16,21-24,31-32H,1-12,17-20,25-26H2; |
| InChIKey | BRUXQKAYLPIMEV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese?
The IUPAC name of 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese (CID 157442351) is 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese.
What is the SMILES notation for 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese?
The canonical SMILES for 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese is O=S(=O)(c1ccccc1CCCCCCCCCO)c1ccccc1CCCCCCCCCO.[Mn].
What is the InChIKey of 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese?
The InChIKey is BRUXQKAYLPIMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H46O4S.Mn/c31-25-17-9-5-1-3-7-11-19-27-21-13-15-23-29(27)35(33,34)30-24-16-14-22-28(30)20-12-8-4-2-6-10-18-26-32;/h13-16,21-24,31-32H,1-12,17-20,25-26H2;.
What are the key properties of 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese?
9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese has a molecular weight of 557.70 g/mol, XLogP of 7.05, 20 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-[2-(9-hydroxynonyl)phenyl]sulfonylphenyl]nonan-1-ol;manganese is sourced from PubChem (CID 157442351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).