C10H17F3N2O4S — CID 157443060
(2S)-2-acetamido-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;sulfane (PubChem CID 157443060) has the molecular formula C10H17F3N2O4S and a molecular weight of 318.32 g/mol. Its IUPAC name is (2S)-2-acetamido-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;sulfane.
| Compound Name | (2S)-2-acetamido-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;sulfane |
|---|---|
| PubChem CID | 157443060 |
| Molecular Formula | C10H17F3N2O4S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2S)-2-acetamido-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;sulfane |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)O.S |
| InChI | InChI=1S/C10H15F3N2O4.H2S/c1-6(16)15-7(8(17)18)4-2-3-5-14-9(19)10(11,12)13;/h7H,2-5H2,1H3,(H,14,19)(H,15,16)(H,17,18);1H2/t7-;/m0./s1 |
| InChIKey | BRWZYRXSNRKDGK-FJXQXJEOSA-N |
| XLogP | 0.54 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|