About 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene
5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene (PubChem CID 157443073) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene |
| PubChem CID | 157443073 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene |
| SMILES | C=C.Cc1cc2nn(C(C)C)nc2cc1C |
| InChI | InChI=1S/C11H15N3.C2H4/c1-7(2)14-12-10-5-8(3)9(4)6-11(10)13-14;1-2/h5-7H,1-4H3;1-2H2 |
| InChIKey | BRXAKXODEFMEAA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene?
The IUPAC name of 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene (CID 157443073) is 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene.
What is the SMILES notation for 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene?
The canonical SMILES for 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene is C=C.Cc1cc2nn(C(C)C)nc2cc1C.
What is the InChIKey of 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene?
The InChIKey is BRXAKXODEFMEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3.C2H4/c1-7(2)14-12-10-5-8(3)9(4)6-11(10)13-14;1-2/h5-7H,1-4H3;1-2H2.
What are the key properties of 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene?
5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene has a molecular weight of 217.32 g/mol, XLogP of 3.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-propan-2-ylbenzotriazole;ethene is sourced from PubChem (CID 157443073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).