C10H16 — CID 15744327
(E,6S)-4,6-dimethyloct-4-en-2-yne (PubChem CID 15744327) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (E,6S)-4,6-dimethyloct-4-en-2-yne.
| Compound Name | (E,6S)-4,6-dimethyloct-4-en-2-yne |
|---|---|
| PubChem CID | 15744327 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (E,6S)-4,6-dimethyloct-4-en-2-yne |
| SMILES | CC#C/C(C)=C/[C@@H](C)CC |
| InChI | InChI=1S/C10H16/c1-5-7-10(4)8-9(3)6-2/h8-9H,6H2,1-4H3/b10-8+/t9-/m0/s1 |
| InChIKey | VHMCUNDXSHEZRR-WKMLFNHBSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|