About 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium
7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium (PubChem CID 15744371) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium.
Molecular Properties
| Compound Name | 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium |
| PubChem CID | 15744371 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium |
| SMILES | Cc1ccnc2no[n+]([O-])c12 |
| InChI | InChI=1S/C6H5N3O2/c1-4-2-3-7-6-5(4)9(10)11-8-6/h2-3H,1H3 |
| InChIKey | YPTSBYVTYHPWMP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium?
The IUPAC name of 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium (CID 15744371) is 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium.
What is the SMILES notation for 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium?
The canonical SMILES for 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium is Cc1ccnc2no[n+]([O-])c12.
What is the InChIKey of 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium?
The InChIKey is YPTSBYVTYHPWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c1-4-2-3-7-6-5(4)9(10)11-8-6/h2-3H,1H3.
What are the key properties of 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium?
7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium has a molecular weight of 151.12 g/mol, XLogP of 0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1-oxido-[1,2,5]oxadiazolo[3,4-b]pyridin-1-ium is sourced from PubChem (CID 15744371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).