C24H16F12O3 — CID 157443739
4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenol (PubChem CID 157443739) has the molecular formula C24H16F12O3 and a molecular weight of 580.37 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenol |
|---|---|
| PubChem CID | 157443739 |
| Molecular Formula | C24H16F12O3 |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenol |
| SMILES | Oc1ccc(C(C(F)(F)F)C(F)(F)F)cc1.Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6O2.C9H6F6O/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10;10-8(11,12)7(9(13,14)15)5-1-3-6(16)4-2-5/h1-8,22-23H;1-4,7,16H |
| InChIKey | BRZAGIFMOJKHPS-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |