C36H30N4O3S3 — CID 157443869
hepta-1,2,3,4,5,6-hexaene;methyl 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoate;N-methylhexa-1,2,3,4,5-pentaen-1-imine (PubChem CID 157443869) has the molecular formula C36H30N4O3S3 and a molecular weight of 662.86 g/mol. Its IUPAC name is hepta-1,2,3,4,5,6-hexaene;methyl 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoate;N-methylhexa-1,2,3,4,5-pentaen-1-imine.
| Compound Name | hepta-1,2,3,4,5,6-hexaene;methyl 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoate;N-methylhexa-1,2,3,4,5-pentaen-1-imine |
|---|---|
| PubChem CID | 157443869 |
| Molecular Formula | C36H30N4O3S3 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | hepta-1,2,3,4,5,6-hexaene;methyl 4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]benzoate;N-methylhexa-1,2,3,4,5-pentaen-1-imine |
| SMILES | C=C=C=C=C=C=C.C=C=C=C=C=C=NC.CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(C(=O)OC)cc3)c2c1N |
| InChI | InChI=1S/C22H21N3O3S3.C7H5N.C7H4/c1-3-4-11-31(27)22-18(23)17-15(13-5-7-14(8-6-13)21(26)28-2)12-16(25-20(17)30-22)19-24-9-10-29-19;1-3-4-5-6-7-8-2;1-3-5-7-6-4-2/h5-10,12H,3-4,11,23H2,1-2H3;1H2,2H3;1-2H2 |
| InChIKey | BRZLXIRPRIXTBU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|