About methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one
methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one (PubChem CID 157443912) has the molecular formula C17H37N3O3
and a molecular weight of 331.50 g/mol. Its IUPAC name is methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one |
| PubChem CID | 157443912 |
| Molecular Formula | C17H37N3O3 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.28 |
| IUPAC Name | methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one |
| SMILES | C.C.CCC(=O)N1CCN(C)CC1.CCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C8H16N2O.C7H13NO2.2CH4/c1-3-8(11)10-6-4-9(2)5-7-10;1-2-7(9)8-3-5-10-6-4-8;;/h3-7H2,1-2H3;2-6H2,1H3;2*1H4 |
| InChIKey | BRZPFBUCEUHTIC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one?
The IUPAC name of methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one (CID 157443912) is methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one?
The canonical SMILES for methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one is C.C.CCC(=O)N1CCN(C)CC1.CCC(=O)N1CCOCC1.
What is the InChIKey of methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one?
The InChIKey is BRZPFBUCEUHTIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C7H13NO2.2CH4/c1-3-8(11)10-6-4-9(2)5-7-10;1-2-7(9)8-3-5-10-6-4-8;;/h3-7H2,1-2H3;2-6H2,1H3;2*1H4.
What are the key properties of methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one?
methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one has a molecular weight of 331.50 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(4-methylpiperazin-1-yl)propan-1-one;1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 157443912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).