C20H20F3N5O — CID 157444096
1-[(3S)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-(2,4,5-trifluoroanilino)propan-2-one (PubChem CID 157444096) has the molecular formula C20H20F3N5O and a molecular weight of 403.41 g/mol. Its IUPAC name is 1-[(3S)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-(2,4,5-trifluoroanilino)propan-2-one.
| Compound Name | 1-[(3S)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-(2,4,5-trifluoroanilino)propan-2-one |
|---|---|
| PubChem CID | 157444096 |
| Molecular Formula | C20H20F3N5O |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[(3S)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-(2,4,5-trifluoroanilino)propan-2-one |
| SMILES | O=C(CNc1cc(F)c(F)cc1F)C[C@@H]1CCCN(c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C20H20F3N5O/c21-15-7-17(23)18(8-16(15)22)25-9-13(29)6-12-2-1-5-28(10-12)20-14-3-4-24-19(14)26-11-27-20/h3-4,7-8,11-12,25H,1-2,5-6,9-10H2,(H,24,26,27)/t12-/m0/s1 |
| InChIKey | BSABGMCCCCYVIP-LBPRGKRZSA-N |
| XLogP | 3.66 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|