C15H18N2O2S — CID 157444493
6-methylidene-2-(3-methylthiophene-2-carbonyl)-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazin-9-one (PubChem CID 157444493) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-methylidene-2-(3-methylthiophene-2-carbonyl)-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazin-9-one.
| Compound Name | 6-methylidene-2-(3-methylthiophene-2-carbonyl)-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 157444493 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 6-methylidene-2-(3-methylthiophene-2-carbonyl)-1,3,4,7,8,9a-hexahydropyrido[1,2-a]pyrazin-9-one |
| SMILES | C=C1CCC(=O)C2CN(C(=O)c3sccc3C)CCN12 |
| InChI | InChI=1S/C15H18N2O2S/c1-10-5-8-20-14(10)15(19)16-6-7-17-11(2)3-4-13(18)12(17)9-16/h5,8,12H,2-4,6-7,9H2,1H3 |
| InChIKey | RMZBVAYCBQWNSY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |