sulfamoyl chloride

H4Cl2N2O4S2 — CID 157444585

IUPACsulfamoyl chloride
SMILESNS(=O)(=O)Cl.NS(=O)(=O)Cl
InChIInChI=1S/2ClH2NO2S/c2*1-5(2,3)4/h2*(H2,2,3,4)
InChIKeyBSBMDTVWLJAAEI-UHFFFAOYSA-N
MW231.08 g/mol
LogP-1.14
Rot. Bonds

About sulfamoyl chloride

sulfamoyl chloride (PubChem CID 157444585) has the molecular formula H4Cl2N2O4S2 and a molecular weight of 231.08 g/mol. Its IUPAC name is sulfamoyl chloride.

Molecular Properties

Compound Namesulfamoyl chloride
PubChem CID157444585
Molecular FormulaH4Cl2N2O4S2
Molecular Weight231.08 g/mol
Exact Mass229.90
IUPAC Namesulfamoyl chloride
SMILESNS(=O)(=O)Cl.NS(=O)(=O)Cl
InChIInChI=1S/2ClH2NO2S/c2*1-5(2,3)4/h2*(H2,2,3,4)
InChIKeyBSBMDTVWLJAAEI-UHFFFAOYSA-N
XLogP-1.14
TPSA120.32 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.08
LogP ≤ 5-1.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfamoyl chloride?
The IUPAC name of sulfamoyl chloride (CID 157444585) is sulfamoyl chloride.
What is the SMILES notation for sulfamoyl chloride?
The canonical SMILES for sulfamoyl chloride is NS(=O)(=O)Cl.NS(=O)(=O)Cl.
What is the InChIKey of sulfamoyl chloride?
The InChIKey is BSBMDTVWLJAAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClH2NO2S/c2*1-5(2,3)4/h2*(H2,2,3,4).
What are the key properties of sulfamoyl chloride?
sulfamoyl chloride has a molecular weight of 231.08 g/mol, XLogP of -1.14, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfamoyl chloride is sourced from PubChem (CID 157444585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).