About 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide
4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide (PubChem CID 157445420) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide.
Molecular Properties
| Compound Name | 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide |
| PubChem CID | 157445420 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide |
| SMILES | CC(CCC(N)=O)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C15H19NO/c1-15(11-10-14(16)17,12-6-2-3-7-12)13-8-4-5-9-13/h2-6,8H,7,9-11H2,1H3,(H2,16,17) |
| InChIKey | INFDREPHVLAFAT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide?
The IUPAC name of 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide (CID 157445420) is 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide.
What is the SMILES notation for 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide?
The canonical SMILES for 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide is CC(CCC(N)=O)(C1=CC=CC1)C1=CC=CC1.
What is the InChIKey of 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide?
The InChIKey is INFDREPHVLAFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c1-15(11-10-14(16)17,12-6-2-3-7-12)13-8-4-5-9-13/h2-6,8H,7,9-11H2,1H3,(H2,16,17).
What are the key properties of 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide?
4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide has a molecular weight of 229.32 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-di(cyclopenta-1,3-dien-1-yl)pentanamide is sourced from PubChem (CID 157445420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).