C7H16O2Si — CID 157445908
ethenyl-ethyl-(2-methoxyethoxy)silane (PubChem CID 157445908) has the molecular formula C7H16O2Si and a molecular weight of 160.29 g/mol. Its IUPAC name is ethenyl-ethyl-(2-methoxyethoxy)silane.
| Compound Name | ethenyl-ethyl-(2-methoxyethoxy)silane |
|---|---|
| PubChem CID | 157445908 |
| Molecular Formula | C7H16O2Si |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | ethenyl-ethyl-(2-methoxyethoxy)silane |
| SMILES | C=C[SiH](CC)OCCOC |
| InChI | InChI=1S/C7H16O2Si/c1-4-10(5-2)9-7-6-8-3/h4,10H,1,5-7H2,2-3H3 |
| InChIKey | BSFHLBJIXLKJCD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|