C38H37FN4O4 — CID 157446049
9-[4-[2-fluoro-1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-N-methyl-9-oxononanamide (PubChem CID 157446049) has the molecular formula C38H37FN4O4 and a molecular weight of 632.74 g/mol. Its IUPAC name is 9-[4-[2-fluoro-1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-N-methyl-9-oxononanamide.
| Compound Name | 9-[4-[2-fluoro-1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-N-methyl-9-oxononanamide |
|---|---|
| PubChem CID | 157446049 |
| Molecular Formula | C38H37FN4O4 |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 9-[4-[2-fluoro-1,3-dioxo-4-quinolin-8-yl-1-(quinolin-8-ylamino)butan-2-yl]phenyl]-N-methyl-9-oxononanamide |
| SMILES | CNC(=O)CCCCCCCC(=O)c1ccc(C(F)(C(=O)Cc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C38H37FN4O4/c1-40-34(46)18-6-4-2-3-5-17-32(44)26-19-21-30(22-20-26)38(39,33(45)25-29-13-7-11-27-14-9-23-41-35(27)29)37(47)43-31-16-8-12-28-15-10-24-42-36(28)31/h7-16,19-24H,2-6,17-18,25H2,1H3,(H,40,46)(H,43,47) |
| InChIKey | OHBBGUIRJPXROD-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|