About 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine
5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine (PubChem CID 157446094) has the molecular formula C24H33ClN2O2
and a molecular weight of 416.99 g/mol. Its IUPAC name is 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine.
Molecular Properties
| Compound Name | 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine |
| PubChem CID | 157446094 |
| Molecular Formula | C24H33ClN2O2 |
| Molecular Weight | 416.99 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine |
| SMILES | CCCCc1cnc(OC)c(Cl)c1.c1ccc([C@@H]2CCOC3(CCCC3)C2)nc1 |
| InChI | InChI=1S/C14H19NO.C10H14ClNO/c1-4-9-15-13(5-1)12-6-10-16-14(11-12)7-2-3-8-14;1-3-4-5-8-6-9(11)10(13-2)12-7-8/h1,4-5,9,12H,2-3,6-8,10-11H2;6-7H,3-5H2,1-2H3/t12-;/m1./s1 |
| InChIKey | BSFVJGNATDNVAD-UTONKHPSSA-N |
| XLogP | 6.37 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.99 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine?
The IUPAC name of 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine (CID 157446094) is 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine.
What is the SMILES notation for 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine?
The canonical SMILES for 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine is CCCCc1cnc(OC)c(Cl)c1.c1ccc([C@@H]2CCOC3(CCCC3)C2)nc1.
What is the InChIKey of 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine?
The InChIKey is BSFVJGNATDNVAD-UTONKHPSSA-N. The full InChI is InChI=1S/C14H19NO.C10H14ClNO/c1-4-9-15-13(5-1)12-6-10-16-14(11-12)7-2-3-8-14;1-3-4-5-8-6-9(11)10(13-2)12-7-8/h1,4-5,9,12H,2-3,6-8,10-11H2;6-7H,3-5H2,1-2H3/t12-;/m1./s1.
What are the key properties of 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine?
5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine has a molecular weight of 416.99 g/mol, XLogP of 6.37, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-3-chloro-2-methoxypyridine;2-[(9R)-6-oxaspiro[4.5]decan-9-yl]pyridine is sourced from PubChem (CID 157446094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).