C32H42N6O4 — CID 157446362
4-[4-amino-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol;N,N-diethylprop-2-enamide (PubChem CID 157446362) has the molecular formula C32H42N6O4 and a molecular weight of 574.73 g/mol. Its IUPAC name is 4-[4-amino-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol;N,N-diethylprop-2-enamide.
| Compound Name | 4-[4-amino-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol;N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 157446362 |
| Molecular Formula | C32H42N6O4 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | 4-[4-amino-2-[3-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]propoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-ol;N,N-diethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC.Nc1nc(OCCCN2C[C@@H]3C[C@H]2CO3)nc2c1CCN(c1cc(O)cc3ccccc13)C2 |
| InChI | InChI=1S/C25H29N5O3.C7H13NO/c26-24-21-6-8-30(23-12-18(31)10-16-4-1-2-5-20(16)23)14-22(21)27-25(28-24)32-9-3-7-29-13-19-11-17(29)15-33-19;1-4-7(9)8(5-2)6-3/h1-2,4-5,10,12,17,19,31H,3,6-9,11,13-15H2,(H2,26,27,28);4H,1,5-6H2,2-3H3/t17-,19-;/m0./s1 |
| InChIKey | BSGRCSWZHREKEF-QQTWVUFVSA-N |
| XLogP | 3.76 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|