About 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine
5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine (PubChem CID 157446765) has the molecular formula C18H32N2
and a molecular weight of 276.47 g/mol. Its IUPAC name is 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine.
Molecular Properties
| Compound Name | 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine |
| PubChem CID | 157446765 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine |
| SMILES | CC(C)(C)Cc1ncc(C(C)(C)C)nc1CC(C)(C)C |
| InChI | InChI=1S/C18H32N2/c1-16(2,3)10-13-14(11-17(4,5)6)20-15(12-19-13)18(7,8)9/h12H,10-11H2,1-9H3 |
| InChIKey | XTDXXLNRABDDIO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine?
The IUPAC name of 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine (CID 157446765) is 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine.
What is the SMILES notation for 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine?
The canonical SMILES for 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine is CC(C)(C)Cc1ncc(C(C)(C)C)nc1CC(C)(C)C.
What is the InChIKey of 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine?
The InChIKey is XTDXXLNRABDDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2/c1-16(2,3)10-13-14(11-17(4,5)6)20-15(12-19-13)18(7,8)9/h12H,10-11H2,1-9H3.
What are the key properties of 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine?
5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine has a molecular weight of 276.47 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2,3-bis(2,2-dimethylpropyl)pyrazine is sourced from PubChem (CID 157446765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).