C35H39Br2N7 — CID 157447497
2-bromo-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole;2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole;9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine (PubChem CID 157447497) has the molecular formula C35H39Br2N7 and a molecular weight of 717.55 g/mol. Its IUPAC name is 2-bromo-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole;2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole;9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine.
| Compound Name | 2-bromo-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole;2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole;9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
|---|---|
| PubChem CID | 157447497 |
| Molecular Formula | C35H39Br2N7 |
| Molecular Weight | 717.55 g/mol |
| Exact Mass | 715.16 |
| IUPAC Name | 2-bromo-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indole;2-bromo-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]indole;9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-amine |
| SMILES | Brc1ccc2c3c([nH]c2n1)CCCC3.Cn1c2c(c3ccc(Br)nc31)CCCC2.Cn1c2c(c3ccc(N)nc31)CCCC2 |
| InChI | InChI=1S/C12H13BrN2.C12H15N3.C11H11BrN2/c2*1-15-10-5-3-2-4-8(10)9-6-7-11(13)14-12(9)15;12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h6-7H,2-5H2,1H3;6-7H,2-5H2,1H3,(H2,13,14);5-6H,1-4H2,(H,13,14) |
| InChIKey | BSKBICKFQXFPOY-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.55 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|