C28H35NO9 — CID 157447966
2-hydroxybutyl 4-cyanobenzoate;2-hydroxybutyl 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate (PubChem CID 157447966) has the molecular formula C28H35NO9 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-hydroxybutyl 4-cyanobenzoate;2-hydroxybutyl 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate.
| Compound Name | 2-hydroxybutyl 4-cyanobenzoate;2-hydroxybutyl 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
|---|---|
| PubChem CID | 157447966 |
| Molecular Formula | C28H35NO9 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 2-hydroxybutyl 4-cyanobenzoate;2-hydroxybutyl 4-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
| SMILES | CCC(O)COC(=O)c1ccc(C#N)cc1.CCC(O)COC(=O)c1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22O6.C12H13NO3/c1-5-12(17)10-20-14(18)11-6-8-13(9-7-11)21-15(19)22-16(2,3)4;1-2-11(14)8-16-12(15)10-5-3-9(7-13)4-6-10/h6-9,12,17H,5,10H2,1-4H3;3-6,11,14H,2,8H2,1H3 |
| InChIKey | BSLJIWSHJFTAFN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 152.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|