C26H19N5 — CID 157447989
N-phenyl-3-pyrimidin-2-yl-N-(3-pyrimidin-2-ylphenyl)aniline (PubChem CID 157447989) has the molecular formula C26H19N5 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-phenyl-3-pyrimidin-2-yl-N-(3-pyrimidin-2-ylphenyl)aniline.
| Compound Name | N-phenyl-3-pyrimidin-2-yl-N-(3-pyrimidin-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 157447989 |
| Molecular Formula | C26H19N5 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-phenyl-3-pyrimidin-2-yl-N-(3-pyrimidin-2-ylphenyl)aniline |
| SMILES | c1ccc(N(c2cccc(-c3ncccn3)c2)c2cccc(-c3ncccn3)c2)cc1 |
| InChI | InChI=1S/C26H19N5/c1-2-10-22(11-3-1)31(23-12-4-8-20(18-23)25-27-14-6-15-28-25)24-13-5-9-21(19-24)26-29-16-7-17-30-26/h1-19H |
| InChIKey | RIKKFQGAHWVTJZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |