About 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid
4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid (PubChem CID 157448141) has the molecular formula C26H36O6
and a molecular weight of 444.57 g/mol. Its IUPAC name is 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid.
Molecular Properties
| Compound Name | 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid |
| PubChem CID | 157448141 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid |
| SMILES | CCC(O)C(C)C(O)CC.CCc1ccc(C(=O)O)cc1.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C9H10O2.C9H8O2.C8H18O2/c1-2-7-3-5-8(6-4-7)9(10)11;10-9(11)7-6-8-4-2-1-3-5-8;1-4-7(9)6(3)8(10)5-2/h3-6H,2H2,1H3,(H,10,11);1-7H,(H,10,11);6-10H,4-5H2,1-3H3 |
| InChIKey | BSLXNTVOBGCTKA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid?
The IUPAC name of 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid (CID 157448141) is 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid.
What is the SMILES notation for 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid?
The canonical SMILES for 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid is CCC(O)C(C)C(O)CC.CCc1ccc(C(=O)O)cc1.O=C(O)C=Cc1ccccc1.
What is the InChIKey of 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid?
The InChIKey is BSLXNTVOBGCTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.C9H8O2.C8H18O2/c1-2-7-3-5-8(6-4-7)9(10)11;10-9(11)7-6-8-4-2-1-3-5-8;1-4-7(9)6(3)8(10)5-2/h3-6H,2H2,1H3,(H,10,11);1-7H,(H,10,11);6-10H,4-5H2,1-3H3.
What are the key properties of 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid?
4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid has a molecular weight of 444.57 g/mol, XLogP of 4.90, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzoic acid;4-methylheptane-3,5-diol;3-phenylprop-2-enoic acid is sourced from PubChem (CID 157448141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).