C70H66N2O2S2 — CID 157449807
2,6-dimethyldibenzofuran;2,8-dimethyldibenzofuran;2,6-dimethyldibenzothiophene;2,8-dimethyldibenzothiophene;2,6-dimethylpyridine;3,5-dimethylpyridine (PubChem CID 157449807) has the molecular formula C70H66N2O2S2 and a molecular weight of 1031.44 g/mol. Its IUPAC name is 2,6-dimethyldibenzofuran;2,8-dimethyldibenzofuran;2,6-dimethyldibenzothiophene;2,8-dimethyldibenzothiophene;2,6-dimethylpyridine;3,5-dimethylpyridine.
| Compound Name | 2,6-dimethyldibenzofuran;2,8-dimethyldibenzofuran;2,6-dimethyldibenzothiophene;2,8-dimethyldibenzothiophene;2,6-dimethylpyridine;3,5-dimethylpyridine |
|---|---|
| PubChem CID | 157449807 |
| Molecular Formula | C70H66N2O2S2 |
| Molecular Weight | 1031.44 g/mol |
| Exact Mass | 1030.46 |
| IUPAC Name | 2,6-dimethyldibenzofuran;2,8-dimethyldibenzofuran;2,6-dimethyldibenzothiophene;2,8-dimethyldibenzothiophene;2,6-dimethylpyridine;3,5-dimethylpyridine |
| SMILES | Cc1ccc2oc3c(C)cccc3c2c1.Cc1ccc2oc3ccc(C)cc3c2c1.Cc1ccc2sc3c(C)cccc3c2c1.Cc1ccc2sc3ccc(C)cc3c2c1.Cc1cccc(C)n1.Cc1cncc(C)c1 |
| InChI | InChI=1S/2C14H12O.2C14H12S.2C7H9N/c1-9-3-5-13-11(7-9)12-8-10(2)4-6-14(12)15-13;1-9-6-7-13-12(8-9)11-5-3-4-10(2)14(11)15-13;1-9-3-5-13-11(7-9)12-8-10(2)4-6-14(12)15-13;1-9-6-7-13-12(8-9)11-5-3-4-10(2)14(11)15-13;1-6-3-7(2)5-8-4-6;1-6-4-3-5-7(2)8-6/h4*3-8H,1-2H3;2*3-5H,1-2H3 |
| InChIKey | BSQYHGYHJGVIEW-UHFFFAOYSA-N |
| XLogP | 21.15 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.44 |
| LogP ≤ 5 | 21.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |