C21H23FN2O3 — CID 157450001
(4aR,8aS)-6-[3-[2-(3-fluoro-2-methylphenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 157450001) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[2-(3-fluoro-2-methylphenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[2-(3-fluoro-2-methylphenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 157450001 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (4aR,8aS)-6-[3-[2-(3-fluoro-2-methylphenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | Cc1c(F)cccc1C#CC1CN(C(=O)N2CC[C@@H]3OCC(=O)C[C@@H]3C2)C1 |
| InChI | InChI=1S/C21H23FN2O3/c1-14-16(3-2-4-19(14)22)6-5-15-10-24(11-15)21(26)23-8-7-20-17(12-23)9-18(25)13-27-20/h2-4,15,17,20H,7-13H2,1H3/t17-,20+/m1/s1 |
| InChIKey | BSRMZRPQWPXFQA-XLIONFOSSA-N |
| XLogP | 2.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|