About bicyclo[2.2.1]heptane-2,5-dicarbonitrile
bicyclo[2.2.1]heptane-2,5-dicarbonitrile (PubChem CID 15745024) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane-2,5-dicarbonitrile |
| PubChem CID | 15745024 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | bicyclo[2.2.1]heptane-2,5-dicarbonitrile |
| SMILES | N#CC1CC2CC1CC2C#N |
| InChI | InChI=1S/C9H10N2/c10-4-8-2-6-1-7(8)3-9(6)5-11/h6-9H,1-3H2 |
| InChIKey | BKRNMGBZNLHGEG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bicyclo[2.2.1]heptane-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane-2,5-dicarbonitrile?
The IUPAC name of bicyclo[2.2.1]heptane-2,5-dicarbonitrile (CID 15745024) is bicyclo[2.2.1]heptane-2,5-dicarbonitrile.
What is the SMILES notation for bicyclo[2.2.1]heptane-2,5-dicarbonitrile?
The canonical SMILES for bicyclo[2.2.1]heptane-2,5-dicarbonitrile is N#CC1CC2CC1CC2C#N.
What is the InChIKey of bicyclo[2.2.1]heptane-2,5-dicarbonitrile?
The InChIKey is BKRNMGBZNLHGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c10-4-8-2-6-1-7(8)3-9(6)5-11/h6-9H,1-3H2.
What are the key properties of bicyclo[2.2.1]heptane-2,5-dicarbonitrile?
bicyclo[2.2.1]heptane-2,5-dicarbonitrile has a molecular weight of 146.19 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane-2,5-dicarbonitrile is sourced from PubChem (CID 15745024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).