About 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane
3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane (PubChem CID 157450705) has the molecular formula C30H25N3O3
and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane.
Molecular Properties
| Compound Name | 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane |
| PubChem CID | 157450705 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane |
| SMILES | C.CC#CCOc1cccc(C#N)c1.N#Cc1cccc(OCC#CCOc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C18H12N2O2.C11H9NO.CH4/c19-13-15-5-3-7-17(11-15)21-9-1-2-10-22-18-8-4-6-16(12-18)14-20;1-2-3-7-13-11-6-4-5-10(8-11)9-12;/h3-8,11-12H,9-10H2;4-6,8H,7H2,1H3;1H4 |
| InChIKey | BSTNMXHMRIDRTI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane?
The IUPAC name of 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane (CID 157450705) is 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane.
What is the SMILES notation for 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane?
The canonical SMILES for 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane is C.CC#CCOc1cccc(C#N)c1.N#Cc1cccc(OCC#CCOc2cccc(C#N)c2)c1.
What is the InChIKey of 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane?
The InChIKey is BSTNMXHMRIDRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2.C11H9NO.CH4/c19-13-15-5-3-7-17(11-15)21-9-1-2-10-22-18-8-4-6-16(12-18)14-20;1-2-3-7-13-11-6-4-5-10(8-11)9-12;/h3-8,11-12H,9-10H2;4-6,8H,7H2,1H3;1H4.
What are the key properties of 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane?
3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane has a molecular weight of 475.55 g/mol, XLogP of 5.49, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-ynoxybenzonitrile;3-[4-(3-cyanophenoxy)but-2-ynoxy]benzonitrile;methane is sourced from PubChem (CID 157450705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).