C28H38N4P2Si — CID 157451346
[1-[2-[phosphanyl-di(pyrazin-2-yl)methyl]-4-trimethylsilylcyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane (PubChem CID 157451346) has the molecular formula C28H38N4P2Si and a molecular weight of 520.67 g/mol. Its IUPAC name is [1-[2-[phosphanyl-di(pyrazin-2-yl)methyl]-4-trimethylsilylcyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane.
| Compound Name | [1-[2-[phosphanyl-di(pyrazin-2-yl)methyl]-4-trimethylsilylcyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane |
|---|---|
| PubChem CID | 157451346 |
| Molecular Formula | C28H38N4P2Si |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | [1-[2-[phosphanyl-di(pyrazin-2-yl)methyl]-4-trimethylsilylcyclopenta-1,4-dien-1-yl]-2-adamantyl]methylphosphane |
| SMILES | C[Si](C)(C)C1=CC(C23CC4CC(CC(C4)C2CP)C3)=C(C(P)(c2cnccn2)c2cnccn2)C1 |
| InChI | InChI=1S/C28H38N4P2Si/c1-35(2,3)21-11-22(27-13-18-8-19(14-27)10-20(9-18)24(27)17-33)23(12-21)28(34,25-15-29-4-6-31-25)26-16-30-5-7-32-26/h4-7,11,15-16,18-20,24H,8-10,12-14,17,33-34H2,1-3H3 |
| InChIKey | CYEVVDHYXNOGII-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|