About 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one
2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one (PubChem CID 157452184) has the molecular formula C8H13BrN2O3S
and a molecular weight of 297.17 g/mol. Its IUPAC name is 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one |
| PubChem CID | 157452184 |
| Molecular Formula | C8H13BrN2O3S |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/NC(=O)C(C)S1.CC(Br)C(=O)O |
| InChI | InChI=1S/C5H8N2OS.C3H5BrO2/c1-3-4(8)7-5(6-2)9-3;1-2(4)3(5)6/h3H,1-2H3,(H,6,7,8);2H,1H3,(H,5,6) |
| InChIKey | BSXTYGZWWIFWFC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one?
The IUPAC name of 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one (CID 157452184) is 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one?
The canonical SMILES for 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one is C/N=C1/NC(=O)C(C)S1.CC(Br)C(=O)O.
What is the InChIKey of 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one?
The InChIKey is BSXTYGZWWIFWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS.C3H5BrO2/c1-3-4(8)7-5(6-2)9-3;1-2(4)3(5)6/h3H,1-2H3,(H,6,7,8);2H,1H3,(H,5,6).
What are the key properties of 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one?
2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one has a molecular weight of 297.17 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropanoic acid;5-methyl-2-methylimino-1,3-thiazolidin-4-one is sourced from PubChem (CID 157452184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).