C42H54O3Si4 — CID 157452555
3-[(2-methylpropan-2-yl)oxy]-1,2-bis(trimethylsilyl)fluoren-9-one;3-trimethylsilyl-1-[2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]prop-2-yn-1-one (PubChem CID 157452555) has the molecular formula C42H54O3Si4 and a molecular weight of 719.23 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxy]-1,2-bis(trimethylsilyl)fluoren-9-one;3-trimethylsilyl-1-[2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]prop-2-yn-1-one.
| Compound Name | 3-[(2-methylpropan-2-yl)oxy]-1,2-bis(trimethylsilyl)fluoren-9-one;3-trimethylsilyl-1-[2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 157452555 |
| Molecular Formula | C42H54O3Si4 |
| Molecular Weight | 719.23 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxy]-1,2-bis(trimethylsilyl)fluoren-9-one;3-trimethylsilyl-1-[2-(4-trimethylsilylbuta-1,3-diynyl)phenyl]prop-2-yn-1-one |
| SMILES | CC(C)(C)Oc1cc2c(c([Si](C)(C)C)c1[Si](C)(C)C)C(=O)c1ccccc1-2.C[Si](C)(C)C#CC#Cc1ccccc1C(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C23H32O2Si2.C19H22OSi2/c1-23(2,3)25-18-14-17-15-12-10-11-13-16(15)20(24)19(17)22(27(7,8)9)21(18)26(4,5)6;1-21(2,3)15-10-9-12-17-11-7-8-13-18(17)19(20)14-16-22(4,5)6/h10-14H,1-9H3;7-8,11,13H,1-6H3 |
| InChIKey | BSYVWNSPJBKLQY-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.23 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|